Chemical Name: N-(3-chloro-4-fluorophenyl)-2-{[12-oxo-11-(prop-2-en-1-yl)-7-thia-9,11-diazatricyclo[6.4.0.0^{2,6}]dodeca-1(8),2(6),9-trien-10-yl]sulfanyl}acetamide
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.
Chemsrc provides CAS#:618393-14-9 MSDS, density, melting point, boiling point, structure, formula, molecular weight, synthetic route, etc. title: CAS No. 618393-14-9 | Chemsrc address: https://m.chemsrc.com/en/baike/3955482.html