10250-60-9
10250-60-9 structure
- Name: 1,5-dimethyl-3-phenylpyrazole
- Chemical Name: 1,5-dimethyl-3-phenylpyrazole
- CAS Number: 10250-60-9
- Molecular Formula: C11H12N2
- Molecular Weight: 172.22600
- Create Date: 2016-08-02 00:53:38
- Modify Date: 2024-01-13 12:42:42
| Name | 1,5-dimethyl-3-phenylpyrazole |
|---|---|
| Synonyms |
1,5-dimethyl-3-phenyl-pyrazole
1,5-Dimethyl-3-phenyl-1H-pyrazol 1,5-dimethyl-3-phenyl-1H-pyrazole InChI=1/C11H12N2/c1-9-8-11(12-13(9)2)10-6-4-3-5-7-10/h3-8H,1-2H 1H-Pyrazole,1,5-dimethyl-3-phenyl |
| Density | 1.03g/cm3 |
|---|---|
| Boiling Point | 281.7ºC at 760mmHg |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.22600 |
| Flash Point | 124.2ºC |
| Exact Mass | 172.10000 |
| PSA | 17.82000 |
| LogP | 2.39550 |
| Vapour Pressure | 0.00599mmHg at 25°C |
| Index of Refraction | 1.572 |
| HS Code | 2933199090 |
|---|
| Precursor 7 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |