diethyl-(3-hydroxy-3,3-diphenylpropyl)-methylazanium,iodide structure
|
Common Name | diethyl-(3-hydroxy-3,3-diphenylpropyl)-methylazanium,iodide | ||
|---|---|---|---|---|
| CAS Number | 100001-06-7 | Molecular Weight | 425.34700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H28INO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | diethyl-(3-hydroxy-3,3-diphenylpropyl)-methylazanium,iodide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H28INO |
|---|---|
| Molecular Weight | 425.34700 |
| Exact Mass | 425.12200 |
| PSA | 20.23000 |
| LogP | 0.80300 |
| InChIKey | HAMINVZRIHBDBO-UHFFFAOYSA-M |
| SMILES | CC[N+](C)(CC)CCC(O)(c1ccccc1)c1ccccc1.[I-] |
|
~%
diethyl-(3-hydr... CAS#:100001-06-7 |
| Literature: Adamson et al. Journal of the Chemical Society, 1949 , p. Spl. 144, 152 |
|
~%
diethyl-(3-hydr... CAS#:100001-06-7 |
| Literature: Adamson et al. Journal of the Chemical Society, 1949 , p. Spl. 144, 152 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Diaethyl-(3-hydroxy-3,3-diphenyl-propyl)-methyl-ammonium,Jodid |
| Methyldiethyl-(3,3-diphenyl-3-hydroxypropyl) ammonium iodide |
| Diethyl(3,3-diphenyl-3-hydroxypropyl)methylammonium iodide |
| diethyl-(3-hydroxy-3,3-diphenyl-propyl)-methyl-ammonium,iodide |
| AMMONIUM,DIETHYL(3,3-DIPHENYL-3-HYDROXYPROPYL)METHYL-,IODIDE |
| N,N-diethyl-3-hydroxy-N-methyl-3,3-diphenylpropan-1-aminium iodide |
| diethyl-(3-hydroxy-3,3-diphenylpropyl)-methylazanium iodide |
| 3,3-Diphenylpropan-3-ol diethylamine methiodide |