glycinamide-beta-carboline-3-carboxylate methyl ester structure
|
Common Name | glycinamide-beta-carboline-3-carboxylate methyl ester | ||
|---|---|---|---|---|
| CAS Number | 100009-01-6 | Molecular Weight | 283.28200 | |
| Density | 1.374g/cm3 | Boiling Point | 620.4ºC at 760mmHg | |
| Molecular Formula | C15H13N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 329ºC | |
| Name | methyl 2-(9H-pyrido[3,4-b]indole-3-carbonylamino)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.374g/cm3 |
|---|---|
| Boiling Point | 620.4ºC at 760mmHg |
| Molecular Formula | C15H13N3O3 |
| Molecular Weight | 283.28200 |
| Flash Point | 329ºC |
| Exact Mass | 283.09600 |
| PSA | 84.08000 |
| LogP | 2.00980 |
| Vapour Pressure | 2.58E-15mmHg at 25°C |
| Index of Refraction | 1.694 |
| InChIKey | KRSQNSNAAQYQQW-UHFFFAOYSA-N |
| SMILES | COC(=O)CNC(=O)c1cc2c(cn1)[nH]c1ccccc12 |
|
~73%
glycinamide-bet... CAS#:100009-01-6 |
| Literature: Lippke; Muller; Schunack Journal of Pharmaceutical Sciences, 1985 , vol. 74, # 6 p. 676 - 680 |
|
~%
glycinamide-bet... CAS#:100009-01-6 |
| Literature: Lippke; Muller; Schunack Journal of Pharmaceutical Sciences, 1985 , vol. 74, # 6 p. 676 - 680 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Glycine,N-(9H-pyrido(3,4-b)indo-3-ylcarbonyl)-,methyl ester |
| Gly-b-ccme |