Fmoc-Ser(tBu)-Ser(Psi(Me,Me)pro)-OH structure
|
Common Name | Fmoc-Ser(tBu)-Ser(Psi(Me,Me)pro)-OH | ||
|---|---|---|---|---|
| CAS Number | 1000164-43-1 | Molecular Weight | 510.579 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 716.2±60.0 °C at 760 mmHg | |
| Molecular Formula | C28H34N2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 386.9±32.9 °C | |
Use of Fmoc-Ser(tBu)-Ser(Psi(Me,Me)pro)-OHFmoc-Ser(tBu)-Ser(psi(Me,Me)pro)-OH is a dipeptide. |
| Name | Fmoc-Ser(tBu)-Ser(Psi(Me,Me)pro)-OH |
|---|---|
| Synonym | More Synonyms |
| Description | Fmoc-Ser(tBu)-Ser(psi(Me,Me)pro)-OH is a dipeptide. |
|---|---|
| Related Catalog |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 716.2±60.0 °C at 760 mmHg |
| Molecular Formula | C28H34N2O7 |
| Molecular Weight | 510.579 |
| Flash Point | 386.9±32.9 °C |
| Exact Mass | 510.236603 |
| LogP | 5.66 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Index of Refraction | 1.569 |
| InChIKey | OXEDICXRSSILSN-GOTSBHOMSA-N |
| SMILES | CC(C)(C)OCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)N1C(C(=O)O)COC1(C)C |
| Water Solubility | Insuluble (1.6E-3 g/L) (25 ºC) |
| 4-Oxazolidinecarboxylic acid, 3-[(2S)-3-(1,1-dimethylethoxy)-2-[[(9H-fluoren-9-ylmethoxy)carbonyl]amino]-1-oxopropyl]-2,2-dimethyl-, (4S)- |
| (4S)-3-{N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-O-(2-methyl-2-propanyl)-L-seryl}-2,2-dimethyl-1,3-oxazolidine-4-carboxylic acid |