4-Chloro-2-nitrophenyl hydrazine hydrochloride
Modify Date: 2025-11-24 19:38:03
4-Chloro-2-nitrophenyl hydrazine hydrochloride structure
|
Common Name | 4-Chloro-2-nitrophenyl hydrazine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 100032-77-7 | Molecular Weight | 224.04500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H7Cl2N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-Chloro-2-nitrophenyl hydrazine hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H7Cl2N3O2 |
|---|---|
| Molecular Weight | 224.04500 |
| Exact Mass | 222.99200 |
| PSA | 83.87000 |
| LogP | 3.63230 |
| InChIKey | LFBBZAYPJSLJCR-UHFFFAOYSA-N |
| SMILES | Cl.NNc1ccc(Cl)cc1[N+](=O)[O-] |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| methyl (4-chloro-2-nitrophenyl)acetate |
| (4-chloro-2-nitro-phenyl)-hydrazine hydrochloride |
| (4-Chloro-2-nitrophenyl)acetic acid methyl ester |
| methyl 2-(2-nitro-4-chlorophenyl)acetate |