2-(2,6-Dioxo-piperidin-1-yl)-ethanesulfonyl chloride structure
|
Common Name | 2-(2,6-Dioxo-piperidin-1-yl)-ethanesulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 1000339-13-8 | Molecular Weight | 239.67700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H10ClNO4S | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Name | 2-(2,6-dioxopiperidin-1-yl)ethanesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H10ClNO4S |
|---|---|
| Molecular Weight | 239.67700 |
| Exact Mass | 239.00200 |
| PSA | 79.90000 |
| LogP | 1.11280 |
| InChIKey | XDXWYZCUAJWIGN-UHFFFAOYSA-N |
| SMILES | O=C1CCCC(=O)N1CCS(=O)(=O)Cl |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 1-[2-(chlorosulfonyl)ethyl]azaperhydroine-2,6-dione |
| F2165-0002 |