5-CHLORO-6-METHYL-3-NITRO-7-AZAINDOLE structure
|
Common Name | 5-CHLORO-6-METHYL-3-NITRO-7-AZAINDOLE | ||
|---|---|---|---|---|
| CAS Number | 1000340-15-7 | Molecular Weight | 211.605 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H6ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-chloro-6-methyl-3-nitro-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Molecular Formula | C8H6ClN3O2 |
| Molecular Weight | 211.605 |
| Exact Mass | 211.014847 |
| PSA | 74.50000 |
| LogP | 3.15 |
| Index of Refraction | 1.711 |
| InChIKey | PIOSNIBFEHUCFW-UHFFFAOYSA-N |
| SMILES | Cc1nc2[nH]cc([N+](=O)[O-])c2cc1Cl |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Chloro-6-methyl-3-nitro-1H-pyrrolo[2,3-b]pyridine |
| 1H-Pyrrolo[2,3-b]pyridine, 5-chloro-6-methyl-3-nitro- |
| 5-Chloro-6-methyl-3-nitro-7-azaindole |