N-Boc-3-dimethylaminopiperidine structure
|
Common Name | N-Boc-3-dimethylaminopiperidine | ||
|---|---|---|---|---|
| CAS Number | 1000576-83-9 | Molecular Weight | 228.331 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 295.4±33.0 °C at 760 mmHg | |
| Molecular Formula | C12H24N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 132.5±25.4 °C | |
| Name | tert-butyl 3-(dimethylamino)piperidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 295.4±33.0 °C at 760 mmHg |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.331 |
| Flash Point | 132.5±25.4 °C |
| Exact Mass | 228.183777 |
| PSA | 32.78000 |
| LogP | 1.27 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.490 |
| InChIKey | HFIAGQNFPTWBQZ-UHFFFAOYSA-N |
| SMILES | CN(C)C1CCCN(C(=O)OC(C)(C)C)C1 |
| HS Code | 2933399090 |
|---|
|
~89%
N-Boc-3-dimethy... CAS#:1000576-83-9 |
| Literature: WO2009/76387 A1, ; Page/Page column 41 ; WO 2009/076387 A1 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Piperidinecarboxylic acid, 3-(dimethylamino)-, 1,1-dimethylethyl ester |
| tert-Butyl-3-(dimethylamino)piperidin-1-carboxylat |
| tert-Butyl 3-(dimethylamino)piperidine-1-carboxylate |
| N-Boc-3-dimethylaminopiperidine |
| 2-Methyl-2-propanyl 3-(dimethylamino)-1-piperidinecarboxylate |
| (R)-TERT-BUTYL 3-(DIMETHYLAMINO)PIPERIDINE-1-CARBOXYLATE |
| 1-(tert-butyloxycarbonyl)-3-dimethylaminopiperidine |