3-(1H-Pyrrolo[2,3-b]pyridin-2-yl)-3-piperidinol
Modify Date: 2025-11-04 14:24:23
![3-(1H-Pyrrolo[2,3-b]pyridin-2-yl)-3-piperidinol Structure](https://www.chemsrc.com/extcaspic/331/1001069-48-2.png)
3-(1H-Pyrrolo[2,3-b]pyridin-2-yl)-3-piperidinol structure
|
Common Name | 3-(1H-Pyrrolo[2,3-b]pyridin-2-yl)-3-piperidinol | ||
|---|---|---|---|---|
| CAS Number | 1001069-48-2 | Molecular Weight | 217.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(1H-Pyrrolo[2,3-b]pyridin-2-yl)-3-piperidinol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H15N3O |
|---|---|
| Molecular Weight | 217.27 |
| InChIKey | LXKWIYXGQRBTMJ-UHFFFAOYSA-N |
| SMILES | OC1(c2cc3cccnc3[nH]2)CCCNC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 3-(1H-Pyrrolo[2,3-b]pyridin-2-yl)-3-piperidinol? |
| A: CAS number of 3-(1H-Pyrrolo[2,3-b]pyridin-2-yl)-3-piperidinol is 1001069-48-2. |
| Q: What is the English name of 3-(1H-Pyrrolo[2,3-b]pyridin-2-yl)-3-piperidinol? |
| A: The English name of 3-(1H-Pyrrolo[2,3-b]pyridin-2-yl)-3-piperidinol is 3-(1H-Pyrrolo[2,3-b]pyridin-2-yl)-3-piperidinol. |
| Q: What is the molecular formula of 3-(1H-Pyrrolo[2,3-b]pyridin-2-yl)-3-piperidinol? |
| A: Molecular formula of 3-(1H-Pyrrolo[2,3-b]pyridin-2-yl)-3-piperidinol is C12H15N3O. |
| Q: What is the molecular weight of 3-(1H-Pyrrolo[2,3-b]pyridin-2-yl)-3-piperidinol? |
| A: Molecular weight of 3-(1H-Pyrrolo[2,3-b]pyridin-2-yl)-3-piperidinol is 217.27. |
| Q: What is the InChIKey of 3-(1H-Pyrrolo[2,3-b]pyridin-2-yl)-3-piperidinol? |
| A: InChIKey of 3-(1H-Pyrrolo[2,3-b]pyridin-2-yl)-3-piperidinol is LXKWIYXGQRBTMJ-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1001069-48-2? |
| A: Chinese name of 1001069-48-2 is 1001069-48-2. |
| Q: What is the SMILES notation of 3-(1H-Pyrrolo[2,3-b]pyridin-2-yl)-3-piperidinol? |
| A: SMILES notation of 3-(1H-Pyrrolo[2,3-b]pyridin-2-yl)-3-piperidinol is OC1(c2cc3cccnc3[nH]2)CCCNC1. |