4-isocyanato-N,N-dimethylbenzamide
Modify Date: 2025-09-10 09:01:26
4-isocyanato-N,N-dimethylbenzamide structure
|
Common Name | 4-isocyanato-N,N-dimethylbenzamide | ||
|---|---|---|---|---|
| CAS Number | 1001185-12-1 | Molecular Weight | 190.20 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-isocyanato-N,N-dimethylbenzamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H10N2O2 |
|---|---|
| Molecular Weight | 190.20 |
| InChIKey | SWLSABQUYDOUTG-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)c1ccc(N=C=O)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 4-isocyanato-N,N-dimethylbenzamide? |
| A: InChIKey of 4-isocyanato-N,N-dimethylbenzamide is SWLSABQUYDOUTG-UHFFFAOYSA-N. |
| Q: What is the English name of 4-isocyanato-N,N-dimethylbenzamide? |
| A: The English name of 4-isocyanato-N,N-dimethylbenzamide is 4-isocyanato-N,N-dimethylbenzamide. |
| Q: What is the molecular formula of 4-isocyanato-N,N-dimethylbenzamide? |
| A: Molecular formula of 4-isocyanato-N,N-dimethylbenzamide is C10H10N2O2. |
| Q: What is the Chinese name of 1001185-12-1? |
| A: Chinese name of 1001185-12-1 is 1001185-12-1. |
| Q: What is the CAS number of 4-isocyanato-N,N-dimethylbenzamide? |
| A: CAS number of 4-isocyanato-N,N-dimethylbenzamide is 1001185-12-1. |
| Q: What is the SMILES notation of 4-isocyanato-N,N-dimethylbenzamide? |
| A: SMILES notation of 4-isocyanato-N,N-dimethylbenzamide is CN(C)C(=O)c1ccc(N=C=O)cc1. |
| Q: What is the molecular weight of 4-isocyanato-N,N-dimethylbenzamide? |
| A: Molecular weight of 4-isocyanato-N,N-dimethylbenzamide is 190.20. |