2-BROMO-7-NITRODIBENZO[B,E][1,4]DIOXINE structure
|
Common Name | 2-BROMO-7-NITRODIBENZO[B,E][1,4]DIOXINE | ||
|---|---|---|---|---|
| CAS Number | 100125-06-2 | Molecular Weight | 308.08400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H6BrNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-bromo-7-nitrodibenzo-p-dioxin |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H6BrNO4 |
|---|---|
| Molecular Weight | 308.08400 |
| Exact Mass | 306.94800 |
| PSA | 64.28000 |
| LogP | 4.77850 |
| InChIKey | NEAQKVYUPNBTNP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])OC3=C(O2)C=C(C=C3)Br |
| HS Code | 2932999099 |
|---|
|
~%
2-BROMO-7-NITRO... CAS#:100125-06-2 |
| Literature: Gilman; Dietrich Journal of the American Chemical Society, 1958 , vol. 80, p. 366 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Brom-7-nitro-dibenzo[1,4]dioxin |
| 2-bromo-7-nitro-dibenzo[1,4]dioxin |
| 2-Bromo-7-nitrodibenzo[b,e][1,4]dioxine |