2-phenylthiazole-4-carboxylic acid N-(methoxy)methylamide structure
|
Common Name | 2-phenylthiazole-4-carboxylic acid N-(methoxy)methylamide | ||
|---|---|---|---|---|
| CAS Number | 1001669-22-2 | Molecular Weight | 248.30100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-phenylthiazole-4-carboxylic acid N-(methoxy)methylamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H12N2O2S |
|---|---|
| Molecular Weight | 248.30100 |
| Exact Mass | 248.06200 |
| PSA | 70.67000 |
| LogP | 2.44350 |
| InChIKey | FPCJTUJMONOSAN-UHFFFAOYSA-N |
| SMILES | CON(C)C(=O)c1csc(-c2ccccc2)n1 |
|
~88%
2-phenylthiazol... CAS#:1001669-22-2 |
| Literature: Li, Feng; Lu, Yan; Li, Wei; Miller, Duane D.; Mahato, Ram I. Journal of Controlled Release, 2010 , vol. 143, # 1 p. 151 - 158 |
|
~%
2-phenylthiazol... CAS#:1001669-22-2 |
| Literature: GTX, INC.; UNIVERSITY OF TENNESSEE RESEARCH FOUNDATION; DALTON, James, T.; MILLER, Duane, D.; AHN, Sunjoo; CHEN, Jianjun; DUKE, Charles; LI, Chien-ming; LI, Wei; LU, Yan; WANG, Zhao Patent: WO2011/109059 A1, 2011 ; |
| 2-phenyl-thiazole-4-carboxylic acid methoxymethylamide |
| 2-phenylthiazole-4-carboxylic acid methoxymethylamide |
| N-methoxy-N-methyl-2-phenylthiazole-4-carboxamide |
| N-methyl-N-methoxy-(2-phenyl-1,3-thiazol-4-yl)carboxamide |