Cotarnine chloride
Modify Date: 2025-09-01 19:30:13
Cotarnine chloride structure
|
Common Name | Cotarnine chloride | ||
|---|---|---|---|---|
| CAS Number | 10018-19-6 | Molecular Weight | 255.69700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Cotarnine chlorideCotarnine chloride is a oxidative degradation product of the drug Noscapine. |
| Name | Cotarnine Chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H14ClNO3 |
|---|---|
| Molecular Weight | 255.69700 |
| Exact Mass | 255.06600 |
| PSA | 30.70000 |
| InChIKey | BWQAGVANIBSWBW-UHFFFAOYSA-M |
| SMILES | COc1c2c(cc3c1OCO3)CC[N+](C)=C2.[Cl-] |
| RIDADR | UN 1544 |
|---|---|
| Packaging Group | II |
| Hazard Class | 6.1(a) |
|
~86%
Cotarnine chloride CAS#:10018-19-6 |
| Literature: Okamoto; Dirnberger; Burgemeister; et al. Archiv der Pharmazie, 1986 , vol. 319, # 12 p. 1122 - 1129 |
|
~%
Cotarnine chloride CAS#:10018-19-6 |
| Literature: Archiv der Pharmazie, , vol. 319, # 12 p. 1122 - 1129 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-Methoxy-6-methyl-7,8-dihydro-[1,3]dioxolo[4,5-g]isochinolinium,Chlorid |
| 7,8-dihydro-4-methoxy-6-methyl-1,3-dioxolo[4,5-g]isoquinolinium chloride |
| Cotarninium,Chlorid |
| 6,7-Methylendioxy-8-methoxy-N-methyl-3,4-dihydro-isochinolin-ion |
| cotarninium,chloride |
| 4-methoxy-6-methyl-7,8-dihydro-[1,3]dioxolo[4,5-g]isoquinolinium,chloride |
| 1,3-Dioxolo[4,5-G]isoquinolinium,7,8-dihydro-4-methoxy-6-methyl-,chloride |