N-[2-(1H-indol-3-yl)ethyl]benzenecarbothioamide structure
|
Common Name | N-[2-(1H-indol-3-yl)ethyl]benzenecarbothioamide | ||
|---|---|---|---|---|
| CAS Number | 10022-75-0 | Molecular Weight | 280.38700 | |
| Density | 1.233g/cm3 | Boiling Point | 486.2ºC at 760mmHg | |
| Molecular Formula | C17H16N2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.9ºC | |
| Name | N-[2-(1H-indol-3-yl)ethyl]benzenecarbothioamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.233g/cm3 |
|---|---|
| Boiling Point | 486.2ºC at 760mmHg |
| Molecular Formula | C17H16N2S |
| Molecular Weight | 280.38700 |
| Flash Point | 247.9ºC |
| Exact Mass | 280.10300 |
| PSA | 66.95000 |
| LogP | 4.08700 |
| Vapour Pressure | 1.32E-09mmHg at 25°C |
| Index of Refraction | 1.707 |
| InChIKey | SEBJYQOWJZGGLP-UHFFFAOYSA-N |
| SMILES | S=C(NCCc1c[nH]c2ccccc12)c1ccccc1 |
| HS Code | 2933990090 |
|---|
|
~96%
N-[2-(1H-indol-... CAS#:10022-75-0 |
| Literature: Ishida; Nakamura; Irie; Oh-Ishi Chemical and Pharmaceutical Bulletin, 1985 , vol. 33, # 8 p. 3237 - 3249 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-<2-(3-Indolyl)ethyl>-thiobenzamid |
| Benzenecarbothioamide,N-(2-(1H-indol-3-yl)ethyl) |
| N-<2-(3-indolyl)ethyl>thiobenzamide |
| N-(2-indol-3-yl-ethyl)-thiobenzamide |
| N-(2-(1H-Indol-3-yl)ethyl)benzenecarbothioamide |