4-[[4-[bis(2-chloroethyl)amino]phenyl]diazenyl]benzenesulfonic acid structure
|
Common Name | 4-[[4-[bis(2-chloroethyl)amino]phenyl]diazenyl]benzenesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 100311-03-3 | Molecular Weight | 402.29500 | |
| Density | 1.38g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H17Cl2N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[[4-[bis(2-chloroethyl)amino]phenyl]diazenyl]benzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38g/cm3 |
|---|---|
| Molecular Formula | C16H17Cl2N3O3S |
| Molecular Weight | 402.29500 |
| Exact Mass | 401.03700 |
| PSA | 90.71000 |
| LogP | 5.71350 |
| Index of Refraction | 1.615 |
| InChIKey | TZZKJIJYMBMITP-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)c1ccc(N=Nc2ccc(N(CCCl)CCCl)cc2)cc1 |
|
~%
4-[[4-[bis(2-ch... CAS#:100311-03-3 |
| Literature: Ross; Warwick Journal of the Chemical Society, 1956 , p. 1364,1366 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| p-((p-(Bis(2-chloroethyl)amino)phenyl)azo)benzenesulfonic acid |
| 4-{4-[Bis-(2-chlor-aethyl)-amino]-phenylazo}-benzolsulfonsaeure |
| Benzenesulfonic acid,p-((p-(bis(2-chloroethyl)amino)phenyl)azo) |
| 4-(4-(Bis(2-chloroethyl)amino)phenylazo)benzenesulfonic acid |