1-bromo-4-[(4-chlorophenyl)sulfanylmethyl]benzene structure
|
Common Name | 1-bromo-4-[(4-chlorophenyl)sulfanylmethyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 100397-85-1 | Molecular Weight | 313.64100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10BrClS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-bromo-4-[(4-chlorophenyl)sulfanylmethyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H10BrClS |
|---|---|
| Molecular Weight | 313.64100 |
| Exact Mass | 311.93800 |
| PSA | 25.30000 |
| LogP | 5.39480 |
| InChIKey | JWAJIOWSSUMBAZ-UHFFFAOYSA-N |
| SMILES | Clc1ccc(SCc2ccc(Br)cc2)cc1 |
|
~86%
1-bromo-4-[(4-c... CAS#:100397-85-1 |
| Literature: Journal of Chemical Research, , # 7 p. 443 - 444 |
|
~%
1-bromo-4-[(4-c... CAS#:100397-85-1 |
| Literature: Journal of the Science of Food and Agriculture, , vol. 8, p. 566,567 |
|
~%
1-bromo-4-[(4-c... CAS#:100397-85-1 |
| Literature: Journal of the Chemical Society, , p. 1062 - 1067 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| (4-bromobenzyl)(4-chlorophenyl)sulfane |
| 4-bromobenzyl 4-chlorophenyl sulfide |
| (4-Brom-benzyl)-(4-chlor-phenyl)-sulfid |
| Benzene,1-bromo-4-[[(4-chlorophenyl)thio]methyl] |