1-(bromomethyl)-4-(4-nitrophenyl)sulfonylbenzene structure
|
Common Name | 1-(bromomethyl)-4-(4-nitrophenyl)sulfonylbenzene | ||
|---|---|---|---|---|
| CAS Number | 100398-04-7 | Molecular Weight | 356.19200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10BrNO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(bromomethyl)-4-(4-nitrophenyl)sulfonylbenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H10BrNO4S |
|---|---|
| Molecular Weight | 356.19200 |
| Exact Mass | 354.95100 |
| PSA | 88.34000 |
| LogP | 4.92650 |
| InChIKey | BOCHNTFSFIEKPM-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)c2ccc(CBr)cc2)cc1 |
|
~%
1-(bromomethyl)... CAS#:100398-04-7 |
| Literature: Varney, Michael D.; Marzoni, Gifford P.; Palmer, Cindy L.; Deal, Judith G.; Webber, Stephanie; et al. Journal of Medicinal Chemistry, 1992 , vol. 35, # 4 p. 663 - 676 |
|
~%
1-(bromomethyl)... CAS#:100398-04-7 |
| Literature: Elliott; Harington Journal of the Chemical Society, 1949 , p. 1374,1376 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| (4-Brommethyl-phenyl)-(4-nitro-phenyl)-sulfon |
| 4-bromomethyl-4'-nitrodiphenylsulphone |
| (4-bromomethyl-phenyl)-(4-nitro-phenyl)-sulfone |
| Benzene,1-(bromomethyl)-4-[(4-nitrophenyl)sulfonyl] |