5-tert-butyl-2-methyl-2-azabicyclo[2.2.0]hex-5-en-3-one
Modify Date: 2025-08-25 20:08:28
![5-tert-butyl-2-methyl-2-azabicyclo[2.2.0]hex-5-en-3-one Structure](https://image.chemsrc.com/caspic/148/100465-38-1.png)
5-tert-butyl-2-methyl-2-azabicyclo[2.2.0]hex-5-en-3-one structure
|
Common Name | 5-tert-butyl-2-methyl-2-azabicyclo[2.2.0]hex-5-en-3-one | ||
|---|---|---|---|---|
| CAS Number | 100465-38-1 | Molecular Weight | 165.23200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H15NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-tert-butyl-2-methyl-2-azabicyclo[2.2.0]hex-5-en-3-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H15NO |
|---|---|
| Molecular Weight | 165.23200 |
| Exact Mass | 165.11500 |
| PSA | 20.31000 |
| LogP | 1.36720 |
| InChIKey | ANYRZMSTHBJZEY-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C2C(C(C)(C)C)=CC21 |
|
~99%
5-tert-butyl-2-... CAS#:100465-38-1 |
| Literature: Matsushima, Ryoka; Terada, Kazuhide Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1985 , p. 1445 - 1448 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-Azabicyclo[2.2.0]hex-5-en-3-one,5-(1,1-dimethylethyl)-2-methyl |