4,6-bis(difluoromethoxy)-2-(methylthio)pyrimidine structure
|
Common Name | 4,6-bis(difluoromethoxy)-2-(methylthio)pyrimidine | ||
|---|---|---|---|---|
| CAS Number | 100478-25-9 | Molecular Weight | 258.19300 | |
| Density | 1.494g/cm3 | Boiling Point | 302.442ºC at 760 mmHg | |
| Molecular Formula | C7H6F4N2O2S | Melting Point | 48ºC | |
| MSDS | N/A | Flash Point | 136.712ºC | |
| Name | 4,6-bis(difluoromethoxy)-2-methylsulfanylpyrimidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.494g/cm3 |
|---|---|
| Boiling Point | 302.442ºC at 760 mmHg |
| Melting Point | 48ºC |
| Molecular Formula | C7H6F4N2O2S |
| Molecular Weight | 258.19300 |
| Flash Point | 136.712ºC |
| Exact Mass | 258.00900 |
| PSA | 69.54000 |
| LogP | 2.40130 |
| Vapour Pressure | 0.002mmHg at 25°C |
| Index of Refraction | 1.469 |
| InChIKey | HURDQHYOXAOOJJ-UHFFFAOYSA-N |
| SMILES | CSc1nc(OC(F)F)cc(OC(F)F)n1 |
| HS Code | 2933599090 |
|---|
|
~%
4,6-bis(difluor... CAS#:100478-25-9 |
| Literature: US4692524 A1, ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,6-Bis(difluoroMethoxy)-2-(Methylthio)pyriMidine |
| B2755 |