5-AMINO-2-(4-CHLORO-PHENYL)-2,4-DIHYDRO-PYRAZOL-3-ONE structure
|
Common Name | 5-AMINO-2-(4-CHLORO-PHENYL)-2,4-DIHYDRO-PYRAZOL-3-ONE | ||
|---|---|---|---|---|
| CAS Number | 10050-12-1 | Molecular Weight | 209.63200 | |
| Density | 1.5g/cm3 | Boiling Point | 362.8ºC at 760mmHg | |
| Molecular Formula | C9H8ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.2ºC | |
| Name | 5-amino-2-(4-chlorophenyl)-4H-pyrazol-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5g/cm3 |
|---|---|
| Boiling Point | 362.8ºC at 760mmHg |
| Molecular Formula | C9H8ClN3O |
| Molecular Weight | 209.63200 |
| Flash Point | 173.2ºC |
| Exact Mass | 209.03600 |
| PSA | 58.69000 |
| LogP | 1.54980 |
| Vapour Pressure | 1.88E-05mmHg at 25°C |
| Index of Refraction | 1.69 |
| InChIKey | PRURDYUNBXAKRX-UHFFFAOYSA-N |
| SMILES | NC1=NN(c2ccc(Cl)cc2)C(=O)C1 |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Amino-2-(4-chloro-phenyl)-2,4-dihydro-pyrazol-3-one |
| 5-amino-2-(4-chloro-phenyl)-1,2-dihydro-pyrazol-3-one |
| 1-(4-Chlorphenyl)-3-aminopyrazolin-5-on |