1H-Indole-4,7-dione, 3-(2-aminoethyl)-5-hydroxy- (9CI) structure
|
Common Name | 1H-Indole-4,7-dione, 3-(2-aminoethyl)-5-hydroxy- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 100513-78-8 | Molecular Weight | 206.19800 | |
| Density | 1.558g/cm3 | Boiling Point | 503.7ºC at 760mmHg | |
| Molecular Formula | C10H10N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 258.4ºC | |
| Name | 3-(2-aminoethyl)-7-hydroxy-1H-indole-4,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.558g/cm3 |
|---|---|
| Boiling Point | 503.7ºC at 760mmHg |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.19800 |
| Flash Point | 258.4ºC |
| Exact Mass | 206.06900 |
| PSA | 96.18000 |
| LogP | 0.88050 |
| Vapour Pressure | 5.75E-11mmHg at 25°C |
| Index of Refraction | 1.715 |
| InChIKey | VLVFDKFQRBITDV-UHFFFAOYSA-N |
| SMILES | NCCc1c[nH]c2c1C(=O)C(=O)C=C2O |
|
~%
1H-Indole-4,7-d... CAS#:100513-78-8 |
| Literature: Tabatabaie; Wrona; Dryhurst Journal of Medicinal Chemistry, 1990 , vol. 33, # 2 p. 667 - 672 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 5-Htp-4,7-dione |
| 5-hydroxytryptamine-4,7-dione |
| 1H-Indole-4,7-dione,3-(2-aminoethyl)-5-hydroxy |