3-(4-ACETOXY-PHENYL)-PROPIONIC ACID ETHYL ESTER structure
|
Common Name | 3-(4-ACETOXY-PHENYL)-PROPIONIC ACID ETHYL ESTER | ||
|---|---|---|---|---|
| CAS Number | 100613-03-4 | Molecular Weight | 236.26400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 3-(4-acetyloxyphenyl)propanoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H16O4 |
|---|---|
| Molecular Weight | 236.26400 |
| Exact Mass | 236.10500 |
| PSA | 52.60000 |
| LogP | 2.10760 |
| InChIKey | ATTBAJVGJKTREB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCc1ccc(OC(C)=O)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
3-(4-ACETOXY-PH... CAS#:100613-03-4 |
| Literature: Pearl Journal of Organic Chemistry, 1959 , vol. 24, p. 736,738 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Benzenepropanoic acid,4-(acetyloxy)-,ethyl ester |
| 3-(4-Acetoxy-phenyl)-propionsaeure-aethylester |
| Hydrocinnamicacid,p-hydroxy-,ethyl ester,acetate (6CI) |
| 3-(4-ACETOXY-PHENYL)-PROPANOIC ACID ETHYL ESTER |
| 3-(4-acetoxy-phenyl)-propionic acid ethyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of ethyl 3-(4-acetyloxyphenyl)propanoate? |
| A: SMILES notation of ethyl 3-(4-acetyloxyphenyl)propanoate is CCOC(=O)CCc1ccc(OC(C)=O)cc1. |
| Q: What is the English name of ethyl 3-(4-acetyloxyphenyl)propanoate? |
| A: The English name of ethyl 3-(4-acetyloxyphenyl)propanoate is ethyl 3-(4-acetyloxyphenyl)propanoate. |
| Q: What is the CAS number of ethyl 3-(4-acetyloxyphenyl)propanoate? |
| A: CAS number of ethyl 3-(4-acetyloxyphenyl)propanoate is 100613-03-4. |
| Q: What English synonyms does ethyl 3-(4-acetyloxyphenyl)propanoate have? |
| A: English synonyms of ethyl 3-(4-acetyloxyphenyl)propanoate: Benzenepropanoic acid,4-(acetyloxy)-,ethyl ester, 3-(4-Acetoxy-phenyl)-propionsaeure-aethylester, Hydrocinnamicacid,p-hydroxy-,ethyl ester,acetate (6CI), 3-(4-ACETOXY-PHENYL)-PROPANOIC ACID ETHYL ESTER, 3-(4-acetoxy-phenyl)-propionic acid ethyl ester. |
| Q: What is the polar surface area (PSA) of ethyl 3-(4-acetyloxyphenyl)propanoate? |
| A: Polar surface area (PSA) of ethyl 3-(4-acetyloxyphenyl)propanoate is 52.60000. |
| Q: What is the molecular weight of ethyl 3-(4-acetyloxyphenyl)propanoate? |
| A: Molecular weight of ethyl 3-(4-acetyloxyphenyl)propanoate is 236.26400. |
| Q: What are the upstream materials of ethyl 3-(4-acetyloxyphenyl)propanoate? |
| A: Related upstream materials(CAS) of ethyl 3-(4-acetyloxyphenyl)propanoate: 25743-64-0. |
| Q: What is the molecular formula of ethyl 3-(4-acetyloxyphenyl)propanoate? |
| A: Molecular formula of ethyl 3-(4-acetyloxyphenyl)propanoate is C13H16O4. |
| Q: What is the Chinese name of 100613-03-4? |
| A: Chinese name of 100613-03-4 is 100613-03-4. |
| Q: What is the LogP of ethyl 3-(4-acetyloxyphenyl)propanoate? |
| A: LogP of ethyl 3-(4-acetyloxyphenyl)propanoate is 2.10760. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |