Methyl 1-(trifluoromethyl)isoquinoline-3-carboxylate structure
|
Common Name | Methyl 1-(trifluoromethyl)isoquinoline-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1006707-71-6 | Molecular Weight | 255.19300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Methyl 1-(trifluoromethyl)isoquinoline-3-carboxylate |
|---|
| Molecular Formula | C12H8F3NO2 |
|---|---|
| Molecular Weight | 255.19300 |
| Exact Mass | 255.05100 |
| PSA | 39.19000 |
| LogP | 3.04020 |
| InChIKey | FHIPSOPUEONRQQ-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc2ccccc2c(C(F)(F)F)n1 |
| HS Code | 2933499090 |
|---|
|
~55%
Methyl 1-(trifl... CAS#:1006707-71-6 |
| Literature: Gilmore, Christopher D.; Allan, Kevin M.; Stoltz, Brian M. Journal of the American Chemical Society, 2008 , vol. 130, # 5 p. 1558 - 1559 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |