cis-(2-Phenylcyclopropyl)methanamine hydrochloride
Modify Date: 2026-06-26 09:03:58
cis-(2-Phenylcyclopropyl)methanamine hydrochloride structure
|
Common Name | cis-(2-Phenylcyclopropyl)methanamine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1007-08-5 | Molecular Weight | 183.68 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H14ClN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | cis-(2-Phenylcyclopropyl)methanamine hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H14ClN |
|---|---|
| Molecular Weight | 183.68 |
| InChIKey | IQFBVCYZPKNMIN-UXQCFNEQSA-N |
| SMILES | C1[C@@H]([C@@H]1C2=CC=CC=C2)CN.Cl |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
Total 6, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of cis-(2-Phenylcyclopropyl)methanamine hydrochloride? |
| A: Molecular formula of cis-(2-Phenylcyclopropyl)methanamine hydrochloride is C10H14ClN. |
| Q: What is the molecular weight of cis-(2-Phenylcyclopropyl)methanamine hydrochloride? |
| A: Molecular weight of cis-(2-Phenylcyclopropyl)methanamine hydrochloride is 183.68. |
| Q: What is the CAS number of cis-(2-Phenylcyclopropyl)methanamine hydrochloride? |
| A: CAS number of cis-(2-Phenylcyclopropyl)methanamine hydrochloride is 1007-08-5. |
| Q: What is the SMILES notation of cis-(2-Phenylcyclopropyl)methanamine hydrochloride? |
| A: SMILES notation of cis-(2-Phenylcyclopropyl)methanamine hydrochloride is C1[C@@H]([C@@H]1C2=CC=CC=C2)CN.Cl. |
| Q: What is the InChIKey of cis-(2-Phenylcyclopropyl)methanamine hydrochloride? |
| A: InChIKey of cis-(2-Phenylcyclopropyl)methanamine hydrochloride is IQFBVCYZPKNMIN-UXQCFNEQSA-N. |
| Q: What is the Chinese name of 1007-08-5? |
| A: Chinese name of 1007-08-5 is 1007-08-5. |
| Q: What is the English name of cis-(2-Phenylcyclopropyl)methanamine hydrochloride? |
| A: The English name of cis-(2-Phenylcyclopropyl)methanamine hydrochloride is cis-(2-Phenylcyclopropyl)methanamine hydrochloride. |