4-bromo-3-methyl-N-(1,3,5-trimethyl-1H-pyrazol-4-yl)benzene-1-sulfonamide
Modify Date: 2026-06-20 18:52:29
4-bromo-3-methyl-N-(1,3,5-trimethyl-1H-pyrazol-4-yl)benzene-1-sulfonamide structure
|
Common Name | 4-bromo-3-methyl-N-(1,3,5-trimethyl-1H-pyrazol-4-yl)benzene-1-sulfonamide | ||
|---|---|---|---|---|
| CAS Number | 1007015-60-2 | Molecular Weight | 358.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16BrN3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-bromo-3-methyl-N-(1,3,5-trimethyl-1H-pyrazol-4-yl)benzene-1-sulfonamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H16BrN3O2S |
|---|---|
| Molecular Weight | 358.26 |
| InChIKey | LCSQPTBRRXPOOJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)S(=O)(=O)NC2=C(N(N=C2C)C)C)Br |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Enzyme Inhibition Assay from US Patent US9156811: "N-myristoyl transferase inhibitors...
Source: BindingDB
Target: N/A
External Id: BindingDB_7254_1
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 4-bromo-3-methyl-N-(1,3,5-trimethyl-1H-pyrazol-4-yl)benzene-1-sulfonamide? |
| A: SMILES notation of 4-bromo-3-methyl-N-(1,3,5-trimethyl-1H-pyrazol-4-yl)benzene-1-sulfonamide is CC1=C(C=CC(=C1)S(=O)(=O)NC2=C(N(N=C2C)C)C)Br. |
| Q: What is the English name of 4-bromo-3-methyl-N-(1,3,5-trimethyl-1H-pyrazol-4-yl)benzene-1-sulfonamide? |
| A: The English name of 4-bromo-3-methyl-N-(1,3,5-trimethyl-1H-pyrazol-4-yl)benzene-1-sulfonamide is 4-bromo-3-methyl-N-(1,3,5-trimethyl-1H-pyrazol-4-yl)benzene-1-sulfonamide. |
| Q: What is the CAS number of 4-bromo-3-methyl-N-(1,3,5-trimethyl-1H-pyrazol-4-yl)benzene-1-sulfonamide? |
| A: CAS number of 4-bromo-3-methyl-N-(1,3,5-trimethyl-1H-pyrazol-4-yl)benzene-1-sulfonamide is 1007015-60-2. |
| Q: What is the Chinese name of 1007015-60-2? |
| A: Chinese name of 1007015-60-2 is 1007015-60-2. |
| Q: What is the molecular formula of 4-bromo-3-methyl-N-(1,3,5-trimethyl-1H-pyrazol-4-yl)benzene-1-sulfonamide? |
| A: Molecular formula of 4-bromo-3-methyl-N-(1,3,5-trimethyl-1H-pyrazol-4-yl)benzene-1-sulfonamide is C13H16BrN3O2S. |
| Q: What is the InChIKey of 4-bromo-3-methyl-N-(1,3,5-trimethyl-1H-pyrazol-4-yl)benzene-1-sulfonamide? |
| A: InChIKey of 4-bromo-3-methyl-N-(1,3,5-trimethyl-1H-pyrazol-4-yl)benzene-1-sulfonamide is LCSQPTBRRXPOOJ-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 4-bromo-3-methyl-N-(1,3,5-trimethyl-1H-pyrazol-4-yl)benzene-1-sulfonamide? |
| A: Molecular weight of 4-bromo-3-methyl-N-(1,3,5-trimethyl-1H-pyrazol-4-yl)benzene-1-sulfonamide is 358.26. |