N,N,2-trimethyl-3-(5-oxophenothiazin-10-yl)propan-1-amine structure
|
Common Name | N,N,2-trimethyl-3-(5-oxophenothiazin-10-yl)propan-1-amine | ||
|---|---|---|---|---|
| CAS Number | 10071-07-5 | Molecular Weight | 314.44500 | |
| Density | 1.24g/cm3 | Boiling Point | 476.1ºC at 760mmHg | |
| Molecular Formula | C18H22N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241.7ºC | |
| Name | N,N,2-trimethyl-3-(5-oxophenothiazin-10-yl)propan-1-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 476.1ºC at 760mmHg |
| Molecular Formula | C18H22N2OS |
| Molecular Weight | 314.44500 |
| Flash Point | 241.7ºC |
| Exact Mass | 314.14500 |
| PSA | 42.76000 |
| LogP | 4.43320 |
| Vapour Pressure | 3.15E-09mmHg at 25°C |
| Index of Refraction | 1.664 |
| InChIKey | XZLXDYORQZVLKR-UHFFFAOYSA-N |
| SMILES | CC(CN(C)C)CN1c2ccccc2S(=O)c2ccccc21 |
| HS Code | 2934300000 |
|---|
| HS Code | 2934300000 |
|---|---|
| Summary | 2934300000. other compounds containing in the structure a phenothiazine ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Alimemazinsulfoxid |
| Alimemazin-sulfoxyd |