dimethyl 2-(1H-indol-3-yl)butanedioate
dimethyl 2-(1H-indol-3-yl)butanedioate structure
|
Common Name | dimethyl 2-(1H-indol-3-yl)butanedioate | ||
|---|---|---|---|---|
| CAS Number | 100711-44-2 | Molecular Weight | 261.27300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | dimethyl 2-(1H-indol-3-yl)butanedioate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H15NO4 |
|---|---|
| Molecular Weight | 261.27300 |
| Exact Mass | 261.10000 |
| PSA | 68.39000 |
| LogP | 1.98760 |
| InChIKey | DBPIJOIVTSVJDZ-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(C(=O)OC)c1c[nH]c2ccccc12 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 1 | |
CAS#:67-56-1
CAS#:10184-94-8
CAS#:6286-56-2
CAS#:186581-53-3
CAS#:19626-92-7This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Indol-3-yl-bernsteinsaeure-dimethylester |
| (3-Indolyl)bernsteinsaeure-dimethylester |
| indol-3-yl-succinic acid dimethyl ester |
| Butanedioic acid,1H-indol-3-yl-,dimethyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of dimethyl 2-(1H-indol-3-yl)butanedioate? |
| A: Molecular formula of dimethyl 2-(1H-indol-3-yl)butanedioate is C14H15NO4. |
| Q: What is the LogP of dimethyl 2-(1H-indol-3-yl)butanedioate? |
| A: LogP of dimethyl 2-(1H-indol-3-yl)butanedioate is 1.98760. |
| Q: What is the polar surface area (PSA) of dimethyl 2-(1H-indol-3-yl)butanedioate? |
| A: Polar surface area (PSA) of dimethyl 2-(1H-indol-3-yl)butanedioate is 68.39000. |
| Q: What is the InChIKey of dimethyl 2-(1H-indol-3-yl)butanedioate? |
| A: InChIKey of dimethyl 2-(1H-indol-3-yl)butanedioate is DBPIJOIVTSVJDZ-UHFFFAOYSA-N. |
| Q: What is the CAS number of dimethyl 2-(1H-indol-3-yl)butanedioate? |
| A: CAS number of dimethyl 2-(1H-indol-3-yl)butanedioate is 100711-44-2. |
| Q: What is the molecular weight of dimethyl 2-(1H-indol-3-yl)butanedioate? |
| A: Molecular weight of dimethyl 2-(1H-indol-3-yl)butanedioate is 261.27300. |
| Q: What English synonyms does dimethyl 2-(1H-indol-3-yl)butanedioate have? |
| A: English synonyms of dimethyl 2-(1H-indol-3-yl)butanedioate: Indol-3-yl-bernsteinsaeure-dimethylester, (3-Indolyl)bernsteinsaeure-dimethylester, indol-3-yl-succinic acid dimethyl ester, Butanedioic acid,1H-indol-3-yl-,dimethyl ester. |
| Q: What are the downstream products of dimethyl 2-(1H-indol-3-yl)butanedioate? |
| A: Related downstream products(CAS) of dimethyl 2-(1H-indol-3-yl)butanedioate: 19626-92-7. |
| Q: What is the English name of dimethyl 2-(1H-indol-3-yl)butanedioate? |
| A: The English name of dimethyl 2-(1H-indol-3-yl)butanedioate is dimethyl 2-(1H-indol-3-yl)butanedioate. |
| Q: What are the upstream materials of dimethyl 2-(1H-indol-3-yl)butanedioate? |
| A: Related upstream materials(CAS) of dimethyl 2-(1H-indol-3-yl)butanedioate: 67-56-1;10184-94-8;6286-56-2;186581-53-3. |