Urea, n'-(chlorosulfonyl)-n,n-diphenyl structure
|
Common Name | Urea, n'-(chlorosulfonyl)-n,n-diphenyl | ||
|---|---|---|---|---|
| CAS Number | 1007126-34-2 | Molecular Weight | 310.76 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H11ClN2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Urea, n'-(chlorosulfonyl)-n,n-diphenyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H11ClN2O3S |
|---|---|
| Molecular Weight | 310.76 |
| InChIKey | WFQMIVUPNSQGBD-UHFFFAOYSA-N |
| SMILES | O=C(NS(=O)(=O)Cl)N(c1ccccc1)c1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1007126-34-2? |
| A: Chinese name of 1007126-34-2 is 1007126-34-2. |
| Q: What is the InChIKey of Urea, n'-(chlorosulfonyl)-n,n-diphenyl? |
| A: InChIKey of Urea, n'-(chlorosulfonyl)-n,n-diphenyl is WFQMIVUPNSQGBD-UHFFFAOYSA-N. |
| Q: What is the English name of Urea, n'-(chlorosulfonyl)-n,n-diphenyl? |
| A: The English name of Urea, n'-(chlorosulfonyl)-n,n-diphenyl is Urea, n'-(chlorosulfonyl)-n,n-diphenyl. |
| Q: What is the molecular formula of Urea, n'-(chlorosulfonyl)-n,n-diphenyl? |
| A: Molecular formula of Urea, n'-(chlorosulfonyl)-n,n-diphenyl is C13H11ClN2O3S. |
| Q: What is the CAS number of Urea, n'-(chlorosulfonyl)-n,n-diphenyl? |
| A: CAS number of Urea, n'-(chlorosulfonyl)-n,n-diphenyl is 1007126-34-2. |
| Q: What is the SMILES notation of Urea, n'-(chlorosulfonyl)-n,n-diphenyl? |
| A: SMILES notation of Urea, n'-(chlorosulfonyl)-n,n-diphenyl is O=C(NS(=O)(=O)Cl)N(c1ccccc1)c1ccccc1. |
| Q: What is the molecular weight of Urea, n'-(chlorosulfonyl)-n,n-diphenyl? |
| A: Molecular weight of Urea, n'-(chlorosulfonyl)-n,n-diphenyl is 310.76. |