5-bromo-6-(oxan-2-yloxymethyl)-1,3-benzodioxole structure
|
Common Name | 5-bromo-6-(oxan-2-yloxymethyl)-1,3-benzodioxole | ||
|---|---|---|---|---|
| CAS Number | 100713-33-5 | Molecular Weight | 315.16000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15BrO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-bromo-6-(oxan-2-yloxymethyl)-1,3-benzodioxole |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H15BrO4 |
|---|---|
| Molecular Weight | 315.16000 |
| Exact Mass | 314.01500 |
| PSA | 36.92000 |
| LogP | 3.22100 |
| InChIKey | PJDCFNHTLBPFMX-UHFFFAOYSA-N |
| SMILES | Brc1cc2c(cc1COC1CCCCO1)OCO2 |
|
~97%
5-bromo-6-(oxan... CAS#:100713-33-5 |
| Literature: Rigby, James H.; Cavezza, Alexandre; Heeg, Mary Jane Journal of the American Chemical Society, 1998 , vol. 120, # 15 p. 3664 - 3670 |
|
~%
5-bromo-6-(oxan... CAS#:100713-33-5 |
| Literature: Rigby, James H.; Cavezza, Alexandre; Heeg, Mary Jane Journal of the American Chemical Society, 1998 , vol. 120, # 15 p. 3664 - 3670 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-bromo-4,5-methylenedioxybenzyl 1-tetrahydropyranyl ether |
| 1,3-Benzodioxole,5-bromo-6-[[(tetrahydro-2H-pyran-2-yl)oxy]methyl] |
| 5-bromo-6-tetrahydropyran-2-yloxymethyl-benzo[1,3]dioxole |