(E)-N-(4-fluorobenzo[d]thiazol-2-yl)-N-(furan-2-ylmethyl)-3-(thiophen-2-yl)acrylamide structure
|
Common Name | (E)-N-(4-fluorobenzo[d]thiazol-2-yl)-N-(furan-2-ylmethyl)-3-(thiophen-2-yl)acrylamide | ||
|---|---|---|---|---|
| CAS Number | 1007226-06-3 | Molecular Weight | 384.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H13FN2O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (E)-N-(4-fluorobenzo[d]thiazol-2-yl)-N-(furan-2-ylmethyl)-3-(thiophen-2-yl)acrylamide |
|---|
| Molecular Formula | C19H13FN2O2S2 |
|---|---|
| Molecular Weight | 384.5 |
| InChIKey | VQZORDVCQRZKGT-CMDGGOBGSA-N |
| SMILES | O=C(C=Cc1cccs1)N(Cc1ccco1)c1nc2c(F)cccc2s1 |
|
Name: Modulation of AMPAR-stargazin complexes
Source: Vanderbilt Screening Center for GPCRs, Ion Channels and Transporters
Target: Stargazin (mouse)
External Id: WaveGuideAssay:441
|