N-(4-chloro-2-methyl-5-morpholin-4-ylphenyl)-3,3-dimethylbutanamide
Modify Date: 2025-08-27 16:41:05
N-(4-chloro-2-methyl-5-morpholin-4-ylphenyl)-3,3-dimethylbutanamide structure
|
Common Name | N-(4-chloro-2-methyl-5-morpholin-4-ylphenyl)-3,3-dimethylbutanamide | ||
|---|---|---|---|---|
| CAS Number | 1007226-97-2 | Molecular Weight | 324.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H25ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(4-chloro-2-methyl-5-morpholin-4-ylphenyl)-3,3-dimethylbutanamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H25ClN2O2 |
|---|---|
| Molecular Weight | 324.8 |
| InChIKey | KXRKPOUJENLPMG-UHFFFAOYSA-N |
| SMILES | Cc1cc(Cl)c(N2CCOCC2)cc1NC(=O)CC(C)(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of N-(4-chloro-2-methyl-5-morpholin-4-ylphenyl)-3,3-dimethylbutanamide? |
| A: The English name of N-(4-chloro-2-methyl-5-morpholin-4-ylphenyl)-3,3-dimethylbutanamide is N-(4-chloro-2-methyl-5-morpholin-4-ylphenyl)-3,3-dimethylbutanamide. |
| Q: What is the CAS number of N-(4-chloro-2-methyl-5-morpholin-4-ylphenyl)-3,3-dimethylbutanamide? |
| A: CAS number of N-(4-chloro-2-methyl-5-morpholin-4-ylphenyl)-3,3-dimethylbutanamide is 1007226-97-2. |
| Q: What is the Chinese name of 1007226-97-2? |
| A: Chinese name of 1007226-97-2 is 1007226-97-2. |
| Q: What is the SMILES notation of N-(4-chloro-2-methyl-5-morpholin-4-ylphenyl)-3,3-dimethylbutanamide? |
| A: SMILES notation of N-(4-chloro-2-methyl-5-morpholin-4-ylphenyl)-3,3-dimethylbutanamide is Cc1cc(Cl)c(N2CCOCC2)cc1NC(=O)CC(C)(C)C. |
| Q: What is the InChIKey of N-(4-chloro-2-methyl-5-morpholin-4-ylphenyl)-3,3-dimethylbutanamide? |
| A: InChIKey of N-(4-chloro-2-methyl-5-morpholin-4-ylphenyl)-3,3-dimethylbutanamide is KXRKPOUJENLPMG-UHFFFAOYSA-N. |
| Q: What is the molecular formula of N-(4-chloro-2-methyl-5-morpholin-4-ylphenyl)-3,3-dimethylbutanamide? |
| A: Molecular formula of N-(4-chloro-2-methyl-5-morpholin-4-ylphenyl)-3,3-dimethylbutanamide is C17H25ClN2O2. |
| Q: What is the molecular weight of N-(4-chloro-2-methyl-5-morpholin-4-ylphenyl)-3,3-dimethylbutanamide? |
| A: Molecular weight of N-(4-chloro-2-methyl-5-morpholin-4-ylphenyl)-3,3-dimethylbutanamide is 324.8. |