1-(2,5-dimethylphenyl)-4-(1H-1,2,4-triazol-1-yl)-1H-pyrazol-5-ol structure
|
Common Name | 1-(2,5-dimethylphenyl)-4-(1H-1,2,4-triazol-1-yl)-1H-pyrazol-5-ol | ||
|---|---|---|---|---|
| CAS Number | 1007237-29-7 | Molecular Weight | 255.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H13N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(2,5-dimethylphenyl)-4-(1H-1,2,4-triazol-1-yl)-1H-pyrazol-5-ol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H13N5O |
|---|---|
| Molecular Weight | 255.28 |
| InChIKey | XAPLAVBULSUBSC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)N2C(=O)C(=CN2)N3C=NC=N3 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Discovery of Small Molecules to Inhibit Human Cytomegalovirus Nuclear Egress
Source: ICCB-Longwood/NSRB Screening Facility, Harvard Medical School
Target: HCMV UL50
External Id: HMS1262
|
|
Name: Chemical Probes of Kaposi's Sarcoma Herpes Virus Latent Infection
Source: ICCB-Longwood/NSRB Screening Facility, Harvard Medical School
Target: ORF 73 [Human herpesvirus 8 type M]
External Id: HMS791
|
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 1-(2,5-dimethylphenyl)-4-(1H-1,2,4-triazol-1-yl)-1H-pyrazol-5-ol? |
| A: Molecular weight of 1-(2,5-dimethylphenyl)-4-(1H-1,2,4-triazol-1-yl)-1H-pyrazol-5-ol is 255.28. |
| Q: What is the molecular formula of 1-(2,5-dimethylphenyl)-4-(1H-1,2,4-triazol-1-yl)-1H-pyrazol-5-ol? |
| A: Molecular formula of 1-(2,5-dimethylphenyl)-4-(1H-1,2,4-triazol-1-yl)-1H-pyrazol-5-ol is C13H13N5O. |
| Q: What is the CAS number of 1-(2,5-dimethylphenyl)-4-(1H-1,2,4-triazol-1-yl)-1H-pyrazol-5-ol? |
| A: CAS number of 1-(2,5-dimethylphenyl)-4-(1H-1,2,4-triazol-1-yl)-1H-pyrazol-5-ol is 1007237-29-7. |
| Q: What is the Chinese name of 1007237-29-7? |
| A: Chinese name of 1007237-29-7 is 1007237-29-7. |
| Q: What is the InChIKey of 1-(2,5-dimethylphenyl)-4-(1H-1,2,4-triazol-1-yl)-1H-pyrazol-5-ol? |
| A: InChIKey of 1-(2,5-dimethylphenyl)-4-(1H-1,2,4-triazol-1-yl)-1H-pyrazol-5-ol is XAPLAVBULSUBSC-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 1-(2,5-dimethylphenyl)-4-(1H-1,2,4-triazol-1-yl)-1H-pyrazol-5-ol? |
| A: SMILES notation of 1-(2,5-dimethylphenyl)-4-(1H-1,2,4-triazol-1-yl)-1H-pyrazol-5-ol is CC1=CC(=C(C=C1)C)N2C(=O)C(=CN2)N3C=NC=N3. |
| Q: What is the English name of 1-(2,5-dimethylphenyl)-4-(1H-1,2,4-triazol-1-yl)-1H-pyrazol-5-ol? |
| A: The English name of 1-(2,5-dimethylphenyl)-4-(1H-1,2,4-triazol-1-yl)-1H-pyrazol-5-ol is 1-(2,5-dimethylphenyl)-4-(1H-1,2,4-triazol-1-yl)-1H-pyrazol-5-ol. |