2,3-dichloro-N-(1,3,5-trimethyl-1H-pyrazol-4-yl)benzene-1-sulfonamide
Modify Date: 2026-05-12 11:06:41
2,3-dichloro-N-(1,3,5-trimethyl-1H-pyrazol-4-yl)benzene-1-sulfonamide structure
|
Common Name | 2,3-dichloro-N-(1,3,5-trimethyl-1H-pyrazol-4-yl)benzene-1-sulfonamide | ||
|---|---|---|---|---|
| CAS Number | 1007237-80-0 | Molecular Weight | 334.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13Cl2N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,3-dichloro-N-(1,3,5-trimethyl-1H-pyrazol-4-yl)benzene-1-sulfonamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H13Cl2N3O2S |
|---|---|
| Molecular Weight | 334.2 |
| InChIKey | DUKICPCHQPYURE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C)C)NS(=O)(=O)C2=C(C(=CC=C2)Cl)Cl |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Enzyme Inhibition Assay from US Patent US9156811: "N-myristoyl transferase inhibitors...
Source: BindingDB
Target: N/A
External Id: BindingDB_7254_1
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2,3-dichloro-N-(1,3,5-trimethyl-1H-pyrazol-4-yl)benzene-1-sulfonamide? |
| A: CAS number of 2,3-dichloro-N-(1,3,5-trimethyl-1H-pyrazol-4-yl)benzene-1-sulfonamide is 1007237-80-0. |
| Q: What is the SMILES notation of 2,3-dichloro-N-(1,3,5-trimethyl-1H-pyrazol-4-yl)benzene-1-sulfonamide? |
| A: SMILES notation of 2,3-dichloro-N-(1,3,5-trimethyl-1H-pyrazol-4-yl)benzene-1-sulfonamide is CC1=C(C(=NN1C)C)NS(=O)(=O)C2=C(C(=CC=C2)Cl)Cl. |
| Q: What is the Chinese name of 1007237-80-0? |
| A: Chinese name of 1007237-80-0 is 1007237-80-0. |
| Q: What is the InChIKey of 2,3-dichloro-N-(1,3,5-trimethyl-1H-pyrazol-4-yl)benzene-1-sulfonamide? |
| A: InChIKey of 2,3-dichloro-N-(1,3,5-trimethyl-1H-pyrazol-4-yl)benzene-1-sulfonamide is DUKICPCHQPYURE-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2,3-dichloro-N-(1,3,5-trimethyl-1H-pyrazol-4-yl)benzene-1-sulfonamide? |
| A: Molecular formula of 2,3-dichloro-N-(1,3,5-trimethyl-1H-pyrazol-4-yl)benzene-1-sulfonamide is C12H13Cl2N3O2S. |
| Q: What is the English name of 2,3-dichloro-N-(1,3,5-trimethyl-1H-pyrazol-4-yl)benzene-1-sulfonamide? |
| A: The English name of 2,3-dichloro-N-(1,3,5-trimethyl-1H-pyrazol-4-yl)benzene-1-sulfonamide is 2,3-dichloro-N-(1,3,5-trimethyl-1H-pyrazol-4-yl)benzene-1-sulfonamide. |
| Q: What is the molecular weight of 2,3-dichloro-N-(1,3,5-trimethyl-1H-pyrazol-4-yl)benzene-1-sulfonamide? |
| A: Molecular weight of 2,3-dichloro-N-(1,3,5-trimethyl-1H-pyrazol-4-yl)benzene-1-sulfonamide is 334.2. |