1-oxy-isonicotinic acid benzylamide structure
|
Common Name | 1-oxy-isonicotinic acid benzylamide | ||
|---|---|---|---|---|
| CAS Number | 100724-08-1 | Molecular Weight | 228.24700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-oxy-isonicotinic acid benzylamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H12N2O2 |
|---|---|
| Molecular Weight | 228.24700 |
| Exact Mass | 228.09000 |
| PSA | 54.56000 |
| LogP | 2.43600 |
| InChIKey | ADBUWOWRJOIKST-UHFFFAOYSA-N |
| SMILES | O=C(NCc1ccccc1)c1cc[n+]([O-])cc1 |
|
~%
1-oxy-isonicoti... CAS#:100724-08-1 |
| Literature: Katritzky; Monro Journal of the Chemical Society, 1958 , p. 150,153 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 1-Oxy-isonicotinsaeure-benzylamid |