Pulchellamine F
Modify Date: 2026-06-29 16:12:46
Pulchellamine F structure
|
Common Name | Pulchellamine F | ||
|---|---|---|---|---|
| CAS Number | 1007346-83-9 | Molecular Weight | 466.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H30N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Pulchellamine F |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C26H30N2O6 |
|---|---|
| Molecular Weight | 466.5 |
| InChIKey | RSGXFKJWMJPECM-XQQBHHJWSA-N |
| SMILES | C=C1C[C@@H]([C@H]2[C@@H](C(=O)O[C@@H]2[C@@H]3[C@H]1C[C@@H](C3=C)O)CN[C@@H](CC4=CNC5=CC=CC=C54)C(=O)O)O |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Cytotoxicity against human SKOV3 cells by SRB assay
Source: ChEMBL
Target: SK-OV-3
External Id: CHEMBL986950
|
|
Name: Cytotoxicity against human A549 cells by SRB assay
Source: ChEMBL
Target: A549
External Id: CHEMBL986949
|
|
Name: Cytotoxicity against human HCT15 cells by SRB assay
Source: ChEMBL
Target: HCT-15
External Id: CHEMBL970186
|
|
Name: Inhibition of HDAC in mouse C127-LT cells assessed as activation of EGFP expression a...
Source: ChEMBL
Target: N/A
External Id: CHEMBL3795029
|
|
Name: Cytotoxicity against human SK-MEL-2 cells by SRB assay
Source: ChEMBL
Target: SK-MEL-2
External Id: CHEMBL986951
|
Total 5, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Pulchellamine F? |
| A: InChIKey of Pulchellamine F is RSGXFKJWMJPECM-XQQBHHJWSA-N. |
| Q: What is the SMILES notation of Pulchellamine F? |
| A: SMILES notation of Pulchellamine F is C=C1C[C@@H]([C@H]2[C@@H](C(=O)O[C@@H]2[C@@H]3[C@H]1C[C@@H](C3=C)O)CN[C@@H](CC4=CNC5=CC=CC=C54)C(=O)O)O. |
| Q: What is the English name of Pulchellamine F? |
| A: The English name of Pulchellamine F is Pulchellamine F. |
| Q: What is the Chinese name of 1007346-83-9? |
| A: Chinese name of 1007346-83-9 is 1007346-83-9. |
| Q: What is the molecular weight of Pulchellamine F? |
| A: Molecular weight of Pulchellamine F is 466.5. |
| Q: What is the molecular formula of Pulchellamine F? |
| A: Molecular formula of Pulchellamine F is C26H30N2O6. |
| Q: What is the CAS number of Pulchellamine F? |
| A: CAS number of Pulchellamine F is 1007346-83-9. |