Egonolpropanoate
Modify Date: 2025-10-04 13:38:58
Egonolpropanoate structure
|
Common Name | Egonolpropanoate | ||
|---|---|---|---|---|
| CAS Number | 1007348-79-9 | Molecular Weight | 382.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H22O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Egonolpropanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H22O6 |
|---|---|
| Molecular Weight | 382.4 |
| InChIKey | XDGRTOUNCQCWMA-UHFFFAOYSA-N |
| SMILES | CCC(=O)OCCCc1cc(OC)c2oc(-c3ccc4c(c3)OCO4)cc2c1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Inhibition of human serum BChE using butyrylthiocholine iodide as substrate by spectr...
Source: ChEMBL
Target: Acetylcholinesterase
External Id: CHEMBL1840096
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Egonolpropanoate? |
| A: InChIKey of Egonolpropanoate is XDGRTOUNCQCWMA-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Egonolpropanoate? |
| A: SMILES notation of Egonolpropanoate is CCC(=O)OCCCc1cc(OC)c2oc(-c3ccc4c(c3)OCO4)cc2c1. |
| Q: What is the English name of Egonolpropanoate? |
| A: The English name of Egonolpropanoate is Egonolpropanoate. |
| Q: What is the Chinese name of 1007348-79-9? |
| A: Chinese name of 1007348-79-9 is 1007348-79-9. |
| Q: What is the CAS number of Egonolpropanoate? |
| A: CAS number of Egonolpropanoate is 1007348-79-9. |
| Q: What is the molecular formula of Egonolpropanoate? |
| A: Molecular formula of Egonolpropanoate is C22H22O6. |
| Q: What is the molecular weight of Egonolpropanoate? |
| A: Molecular weight of Egonolpropanoate is 382.4. |