3-methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid
Modify Date: 2026-07-07 19:41:21
![3-methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid Structure](https://www.chemsrc.com/extcaspic/104/1007386-79-9.png)
3-methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid structure
|
Common Name | 3-methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 1007386-79-9 | Molecular Weight | 165.15 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H7NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H7NO3 |
|---|---|
| Molecular Weight | 165.15 |
| InChIKey | OOWPYBCJKPNETK-UHFFFAOYSA-N |
| SMILES | Cc1coc2cc(C(=O)O)[nH]c12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 3-methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid? |
| A: CAS number of 3-methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid is 1007386-79-9. |
| Q: What is the molecular weight of 3-methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid? |
| A: Molecular weight of 3-methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid is 165.15. |
| Q: What is the English name of 3-methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid? |
| A: The English name of 3-methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid is 3-methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid. |
| Q: What is the InChIKey of 3-methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid? |
| A: InChIKey of 3-methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid is OOWPYBCJKPNETK-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 3-methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid? |
| A: SMILES notation of 3-methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid is Cc1coc2cc(C(=O)O)[nH]c12. |
| Q: What is the Chinese name of 1007386-79-9? |
| A: Chinese name of 1007386-79-9 is 1007386-79-9. |
| Q: What is the molecular formula of 3-methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid? |
| A: Molecular formula of 3-methyl-4H-furo[3,2-b]pyrrole-5-carboxylic acid is C8H7NO3. |