ethyl 4-chloro-6H-thieno[2,3-b]pyrrole-5-carboxylate
Modify Date: 2026-08-03 12:01:31
![ethyl 4-chloro-6H-thieno[2,3-b]pyrrole-5-carboxylate Structure](https://www.chemsrc.com/extcaspic/448/1007387-96-3.png)
ethyl 4-chloro-6H-thieno[2,3-b]pyrrole-5-carboxylate structure
|
Common Name | ethyl 4-chloro-6H-thieno[2,3-b]pyrrole-5-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1007387-96-3 | Molecular Weight | 229.68 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H8ClNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 4-chloro-6H-thieno[2,3-b]pyrrole-5-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H8ClNO2S |
|---|---|
| Molecular Weight | 229.68 |
| InChIKey | UMMMPHUCNBOYFZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1[nH]c2sccc2c1Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1007387-96-3? |
| A: Chinese name of 1007387-96-3 is 1007387-96-3. |
| Q: What is the CAS number of ethyl 4-chloro-6H-thieno[2,3-b]pyrrole-5-carboxylate? |
| A: CAS number of ethyl 4-chloro-6H-thieno[2,3-b]pyrrole-5-carboxylate is 1007387-96-3. |
| Q: What is the molecular formula of ethyl 4-chloro-6H-thieno[2,3-b]pyrrole-5-carboxylate? |
| A: Molecular formula of ethyl 4-chloro-6H-thieno[2,3-b]pyrrole-5-carboxylate is C9H8ClNO2S. |
| Q: What is the InChIKey of ethyl 4-chloro-6H-thieno[2,3-b]pyrrole-5-carboxylate? |
| A: InChIKey of ethyl 4-chloro-6H-thieno[2,3-b]pyrrole-5-carboxylate is UMMMPHUCNBOYFZ-UHFFFAOYSA-N. |
| Q: What is the English name of ethyl 4-chloro-6H-thieno[2,3-b]pyrrole-5-carboxylate? |
| A: The English name of ethyl 4-chloro-6H-thieno[2,3-b]pyrrole-5-carboxylate is ethyl 4-chloro-6H-thieno[2,3-b]pyrrole-5-carboxylate. |
| Q: What is the molecular weight of ethyl 4-chloro-6H-thieno[2,3-b]pyrrole-5-carboxylate? |
| A: Molecular weight of ethyl 4-chloro-6H-thieno[2,3-b]pyrrole-5-carboxylate is 229.68. |
| Q: What is the SMILES notation of ethyl 4-chloro-6H-thieno[2,3-b]pyrrole-5-carboxylate? |
| A: SMILES notation of ethyl 4-chloro-6H-thieno[2,3-b]pyrrole-5-carboxylate is CCOC(=O)c1[nH]c2sccc2c1Cl. |