6-tert-butoxycarbonyl-6H-thieno[2,3-b]pyrrole-5-carboxylic acid ethyl ester
Modify Date: 2025-09-12 11:39:20
![6-tert-butoxycarbonyl-6H-thieno[2,3-b]pyrrole-5-carboxylic acid ethyl ester Structure](https://www.chemsrc.com/extcaspic/147/1007388-68-2.png)
6-tert-butoxycarbonyl-6H-thieno[2,3-b]pyrrole-5-carboxylic acid ethyl ester structure
|
Common Name | 6-tert-butoxycarbonyl-6H-thieno[2,3-b]pyrrole-5-carboxylic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 1007388-68-2 | Molecular Weight | 295.36 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H17NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-tert-butoxycarbonyl-6H-thieno[2,3-b]pyrrole-5-carboxylic acid ethyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H17NO4S |
|---|---|
| Molecular Weight | 295.36 |
| InChIKey | WMMSKVADYMCPTL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc2ccsc2n1C(=O)OC(C)(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 6-tert-butoxycarbonyl-6H-thieno[2,3-b]pyrrole-5-carboxylic acid ethyl ester? |
| A: Molecular formula of 6-tert-butoxycarbonyl-6H-thieno[2,3-b]pyrrole-5-carboxylic acid ethyl ester is C14H17NO4S. |
| Q: What is the SMILES notation of 6-tert-butoxycarbonyl-6H-thieno[2,3-b]pyrrole-5-carboxylic acid ethyl ester? |
| A: SMILES notation of 6-tert-butoxycarbonyl-6H-thieno[2,3-b]pyrrole-5-carboxylic acid ethyl ester is CCOC(=O)c1cc2ccsc2n1C(=O)OC(C)(C)C. |
| Q: What is the English name of 6-tert-butoxycarbonyl-6H-thieno[2,3-b]pyrrole-5-carboxylic acid ethyl ester? |
| A: The English name of 6-tert-butoxycarbonyl-6H-thieno[2,3-b]pyrrole-5-carboxylic acid ethyl ester is 6-tert-butoxycarbonyl-6H-thieno[2,3-b]pyrrole-5-carboxylic acid ethyl ester. |
| Q: What is the CAS number of 6-tert-butoxycarbonyl-6H-thieno[2,3-b]pyrrole-5-carboxylic acid ethyl ester? |
| A: CAS number of 6-tert-butoxycarbonyl-6H-thieno[2,3-b]pyrrole-5-carboxylic acid ethyl ester is 1007388-68-2. |
| Q: What is the InChIKey of 6-tert-butoxycarbonyl-6H-thieno[2,3-b]pyrrole-5-carboxylic acid ethyl ester? |
| A: InChIKey of 6-tert-butoxycarbonyl-6H-thieno[2,3-b]pyrrole-5-carboxylic acid ethyl ester is WMMSKVADYMCPTL-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 6-tert-butoxycarbonyl-6H-thieno[2,3-b]pyrrole-5-carboxylic acid ethyl ester? |
| A: Molecular weight of 6-tert-butoxycarbonyl-6H-thieno[2,3-b]pyrrole-5-carboxylic acid ethyl ester is 295.36. |
| Q: What is the Chinese name of 1007388-68-2? |
| A: Chinese name of 1007388-68-2 is 1007388-68-2. |