Methyl 2-bromo-4-fluoro-5-methoxybenzoate
Methyl 2-bromo-4-fluoro-5-methoxybenzoate structure
|
Common Name | Methyl 2-bromo-4-fluoro-5-methoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 1007455-22-2 | Molecular Weight | 263.06000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H8BrFO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: Methyl 2-bromo-4-fluoro-5-methoxybenzoate (CAS number: 1007455-22-2, molecular formula: C9H8BrFO3, molecular weight: 263.06) For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 2-bromo-4-fluoro-5-methoxybenzoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H8BrFO3 |
|---|---|
| Molecular Weight | 263.06000 |
| Exact Mass | 261.96400 |
| PSA | 35.53000 |
| LogP | 2.38340 |
| InChIKey | KDJBAOOGTMLSCK-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(OC)c(F)cc1Br |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:1007455-23-3This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| methylbromofluoromethoxybenzoate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Methyl 2-bromo-4-fluoro-5-methoxybenzoate? |
| A: SMILES notation of Methyl 2-bromo-4-fluoro-5-methoxybenzoate is COC(=O)c1cc(OC)c(F)cc1Br. |
| Q: What is the Chinese name of 1007455-22-2? |
| A: Chinese name of 1007455-22-2 is 1007455-22-2. |
| Q: What English synonyms does Methyl 2-bromo-4-fluoro-5-methoxybenzoate have? |
| A: English synonyms of Methyl 2-bromo-4-fluoro-5-methoxybenzoate: methylbromofluoromethoxybenzoate. |
| Q: What is the polar surface area (PSA) of Methyl 2-bromo-4-fluoro-5-methoxybenzoate? |
| A: Polar surface area (PSA) of Methyl 2-bromo-4-fluoro-5-methoxybenzoate is 35.53000. |
| Q: What is the molecular formula of Methyl 2-bromo-4-fluoro-5-methoxybenzoate? |
| A: Molecular formula of Methyl 2-bromo-4-fluoro-5-methoxybenzoate is C9H8BrFO3. |
| Q: What is the English name of Methyl 2-bromo-4-fluoro-5-methoxybenzoate? |
| A: The English name of Methyl 2-bromo-4-fluoro-5-methoxybenzoate is Methyl 2-bromo-4-fluoro-5-methoxybenzoate. |
| Q: What is the LogP of Methyl 2-bromo-4-fluoro-5-methoxybenzoate? |
| A: LogP of Methyl 2-bromo-4-fluoro-5-methoxybenzoate is 2.38340. |
| Q: What are the downstream products of Methyl 2-bromo-4-fluoro-5-methoxybenzoate? |
| A: Related downstream products(CAS) of Methyl 2-bromo-4-fluoro-5-methoxybenzoate: 1007455-23-3. |
| Q: What is the molecular weight of Methyl 2-bromo-4-fluoro-5-methoxybenzoate? |
| A: Molecular weight of Methyl 2-bromo-4-fluoro-5-methoxybenzoate is 263.06000. |
| Q: What is the InChIKey of Methyl 2-bromo-4-fluoro-5-methoxybenzoate? |
| A: InChIKey of Methyl 2-bromo-4-fluoro-5-methoxybenzoate is KDJBAOOGTMLSCK-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |