Diethyl 2-phthalimidomalonate-2-13C
Modify Date: 2025-08-28 06:12:47
Diethyl 2-phthalimidomalonate-2-13C structure
|
Common Name | Diethyl 2-phthalimidomalonate-2-13C | ||
|---|---|---|---|---|
| CAS Number | 1007459-54-2 | Molecular Weight | 306.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H15NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Diethyl 2-phthalimidomalonate-2-13C |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H15NO6 |
|---|---|
| Molecular Weight | 306.27 |
| InChIKey | SZNGBHWKVWEBKW-KHWBWMQUSA-N |
| SMILES | CCOC(=O)C(C(=O)OCC)N1C(=O)c2ccccc2C1=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Diethyl 2-phthalimidomalonate-2-13C? |
| A: The English name of Diethyl 2-phthalimidomalonate-2-13C is Diethyl 2-phthalimidomalonate-2-13C. |
| Q: What is the Chinese name of 1007459-54-2? |
| A: Chinese name of 1007459-54-2 is 1007459-54-2. |
| Q: What is the SMILES notation of Diethyl 2-phthalimidomalonate-2-13C? |
| A: SMILES notation of Diethyl 2-phthalimidomalonate-2-13C is CCOC(=O)C(C(=O)OCC)N1C(=O)c2ccccc2C1=O. |
| Q: What is the InChIKey of Diethyl 2-phthalimidomalonate-2-13C? |
| A: InChIKey of Diethyl 2-phthalimidomalonate-2-13C is SZNGBHWKVWEBKW-KHWBWMQUSA-N. |
| Q: What is the molecular weight of Diethyl 2-phthalimidomalonate-2-13C? |
| A: Molecular weight of Diethyl 2-phthalimidomalonate-2-13C is 306.27. |
| Q: What is the CAS number of Diethyl 2-phthalimidomalonate-2-13C? |
| A: CAS number of Diethyl 2-phthalimidomalonate-2-13C is 1007459-54-2. |
| Q: What is the molecular formula of Diethyl 2-phthalimidomalonate-2-13C? |
| A: Molecular formula of Diethyl 2-phthalimidomalonate-2-13C is C15H15NO6. |