N-(2-methylcyclohexen-1-yl)-N-prop-2-enylaniline
N-(2-methylcyclohexen-1-yl)-N-prop-2-enylaniline structure
|
Common Name | N-(2-methylcyclohexen-1-yl)-N-prop-2-enylaniline | ||
|---|---|---|---|---|
| CAS Number | 100747-79-3 | Molecular Weight | 227.34500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H21N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: N-(2-Methylcyclohexen-1-yl)-N-prop-2-enylaniline, CAS number 100747-79-3, molecular formula C16H21N, molecular weight 227.34500. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(2-methylcyclohexen-1-yl)-N-prop-2-enylaniline |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H21N |
|---|---|
| Molecular Weight | 227.34500 |
| Exact Mass | 227.16700 |
| PSA | 3.24000 |
| LogP | 4.52700 |
| InChIKey | MYANDWIXPDHXLD-UHFFFAOYSA-N |
| SMILES | C=CCN(C1=C(C)CCCC1)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~43%
N-(2-methylcycl... CAS#:100747-79-3 |
| Literature: Murahashi, Shun-Ichi; Makabe, Yoshiki; Kunita, Kazuto Journal of Organic Chemistry, 1988 , vol. 53, # 19 p. 4489 - 4495 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Benzenamine,N-(2-methyl-1-cyclohexen-1-yl)-N-2-propenyl |
| N-allyl-N-phenyl-2-methyl-1-cyclohexenylamine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of N-(2-methylcyclohexen-1-yl)-N-prop-2-enylaniline? |
| A: Molecular weight of N-(2-methylcyclohexen-1-yl)-N-prop-2-enylaniline is 227.34500. |
| Q: What is the InChIKey of N-(2-methylcyclohexen-1-yl)-N-prop-2-enylaniline? |
| A: InChIKey of N-(2-methylcyclohexen-1-yl)-N-prop-2-enylaniline is MYANDWIXPDHXLD-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 100747-79-3? |
| A: Chinese name of 100747-79-3 is 100747-79-3. |
| Q: What English synonyms does N-(2-methylcyclohexen-1-yl)-N-prop-2-enylaniline have? |
| A: English synonyms of N-(2-methylcyclohexen-1-yl)-N-prop-2-enylaniline: Benzenamine,N-(2-methyl-1-cyclohexen-1-yl)-N-2-propenyl, N-allyl-N-phenyl-2-methyl-1-cyclohexenylamine. |
| Q: What is the CAS number of N-(2-methylcyclohexen-1-yl)-N-prop-2-enylaniline? |
| A: CAS number of N-(2-methylcyclohexen-1-yl)-N-prop-2-enylaniline is 100747-79-3. |
| Q: What is the polar surface area (PSA) of N-(2-methylcyclohexen-1-yl)-N-prop-2-enylaniline? |
| A: Polar surface area (PSA) of N-(2-methylcyclohexen-1-yl)-N-prop-2-enylaniline is 3.24000. |
| Q: What is the LogP of N-(2-methylcyclohexen-1-yl)-N-prop-2-enylaniline? |
| A: LogP of N-(2-methylcyclohexen-1-yl)-N-prop-2-enylaniline is 4.52700. |
| Q: What are the upstream materials of N-(2-methylcyclohexen-1-yl)-N-prop-2-enylaniline? |
| A: Related upstream materials(CAS) of N-(2-methylcyclohexen-1-yl)-N-prop-2-enylaniline: 589-09-3;583-60-8. |
| Q: What is the SMILES notation of N-(2-methylcyclohexen-1-yl)-N-prop-2-enylaniline? |
| A: SMILES notation of N-(2-methylcyclohexen-1-yl)-N-prop-2-enylaniline is C=CCN(C1=C(C)CCCC1)c1ccccc1. |
| Q: What is the English name of N-(2-methylcyclohexen-1-yl)-N-prop-2-enylaniline? |
| A: The English name of N-(2-methylcyclohexen-1-yl)-N-prop-2-enylaniline is N-(2-methylcyclohexen-1-yl)-N-prop-2-enylaniline. |