N1,N1,N5,N5-Tetramethylnaphthalene-1,5-diamine
N1,N1,N5,N5-Tetramethylnaphthalene-1,5-diamine structure
|
Common Name | N1,N1,N5,N5-Tetramethylnaphthalene-1,5-diamine | ||
|---|---|---|---|---|
| CAS Number | 10075-69-1 | Molecular Weight | 214.30600 | |
| Density | 1.074g/cm3 | Boiling Point | 304.4ºC at 760 mmHg | |
| Molecular Formula | C14H18N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 128.3ºC | |
Summary: 1-N,1-N,5-N,5-N-Tetramethylnaphthalene-1,5-diamine (Chinese name: N1,N1,N5,N5-四甲基萘-1,5-二胺, CAS number: 10075-69-1), molecular formula: C14H18N2, molecular weight: 214.30600. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-N,1-N,5-N,5-N-tetramethylnaphthalene-1,5-diamine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.074g/cm3 |
|---|---|
| Boiling Point | 304.4ºC at 760 mmHg |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.30600 |
| Flash Point | 128.3ºC |
| Exact Mass | 214.14700 |
| PSA | 6.48000 |
| LogP | 2.97180 |
| Vapour Pressure | 0.000879mmHg at 25°C |
| Index of Refraction | 1.649 |
| InChIKey | TYMBOHQMUQAOBA-UHFFFAOYSA-N |
| SMILES | CN(C)c1cccc2c(N(C)C)cccc12 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 6 | |
|---|---|
| DownStream 0 | |
CAS#:77-78-1
CAS#:2243-62-1
CAS#:74-88-4
CAS#:2243-95-0
CAS#:4793-98-0
CAS#:605-71-0This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,5-Bisdimethylaminonaphthalene |
| N,N,N',N'-tetramethylnaphthalene-1,8-diamine |
| N,N,N',N'-Tetramethyl-1,5-naphthalenediamine |
| 1,5-Naphthalenediamine,N,N,N',N'-tetramethyl |
| N,N,N',N'-tetramethyl-1,5-diaminonaphthalene |
| 1,5-Naphthalenediamine,N1,N1,N5,N5-tetramethyl |
| tetra-N-methyl-naphthalene-1,5-diyldiamine |
| 1,5-di(N,N-dimethylamino)naphthalene |
| 1,5-Naphthalenediamine,N,N,N',N'-tetramethyl-(7CI,8CI,9CI) |
| N1,N1,N5,N5-tetramethyl-1,5-diaminonaphthalene |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 10075-69-1? |
| A: Chinese name of 10075-69-1 is 10075-69-1. |
| Q: What is the CAS number of 1-N,1-N,5-N,5-N-tetramethylnaphthalene-1,5-diamine? |
| A: CAS number of 1-N,1-N,5-N,5-N-tetramethylnaphthalene-1,5-diamine is 10075-69-1. |
| Q: What is the polar surface area (PSA) of 1-N,1-N,5-N,5-N-tetramethylnaphthalene-1,5-diamine? |
| A: Polar surface area (PSA) of 1-N,1-N,5-N,5-N-tetramethylnaphthalene-1,5-diamine is 6.48000. |
| Q: What are the upstream materials of 1-N,1-N,5-N,5-N-tetramethylnaphthalene-1,5-diamine? |
| A: Related upstream materials(CAS) of 1-N,1-N,5-N,5-N-tetramethylnaphthalene-1,5-diamine: 77-78-1;2243-62-1;74-88-4;2243-95-0;4793-98-0;605-71-0. |
| Q: What is the SMILES notation of 1-N,1-N,5-N,5-N-tetramethylnaphthalene-1,5-diamine? |
| A: SMILES notation of 1-N,1-N,5-N,5-N-tetramethylnaphthalene-1,5-diamine is CN(C)c1cccc2c(N(C)C)cccc12. |
| Q: What is the InChIKey of 1-N,1-N,5-N,5-N-tetramethylnaphthalene-1,5-diamine? |
| A: InChIKey of 1-N,1-N,5-N,5-N-tetramethylnaphthalene-1,5-diamine is TYMBOHQMUQAOBA-UHFFFAOYSA-N. |
| Q: What is the English name of 1-N,1-N,5-N,5-N-tetramethylnaphthalene-1,5-diamine? |
| A: The English name of 1-N,1-N,5-N,5-N-tetramethylnaphthalene-1,5-diamine is 1-N,1-N,5-N,5-N-tetramethylnaphthalene-1,5-diamine. |
| Q: What is the molecular formula of 1-N,1-N,5-N,5-N-tetramethylnaphthalene-1,5-diamine? |
| A: Molecular formula of 1-N,1-N,5-N,5-N-tetramethylnaphthalene-1,5-diamine is C14H18N2. |
| Q: What is the LogP of 1-N,1-N,5-N,5-N-tetramethylnaphthalene-1,5-diamine? |
| A: LogP of 1-N,1-N,5-N,5-N-tetramethylnaphthalene-1,5-diamine is 2.97180. |
| Q: What is the molecular weight of 1-N,1-N,5-N,5-N-tetramethylnaphthalene-1,5-diamine? |
| A: Molecular weight of 1-N,1-N,5-N,5-N-tetramethylnaphthalene-1,5-diamine is 214.30600. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |