3'-Formyl-2-methoxy-[1,1'-biphenyl]-4-carboxamide
Modify Date: 2025-10-09 17:00:23
![3'-Formyl-2-methoxy-[1,1'-biphenyl]-4-carboxamide Structure](https://www.chemsrc.com/extcaspic/355/1007579-93-2.png)
3'-Formyl-2-methoxy-[1,1'-biphenyl]-4-carboxamide structure
|
Common Name | 3'-Formyl-2-methoxy-[1,1'-biphenyl]-4-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 1007579-93-2 | Molecular Weight | 255.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3'-Formyl-2-methoxy-[1,1'-biphenyl]-4-carboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H13NO3 |
|---|---|
| Molecular Weight | 255.27 |
| InChIKey | NWJYPHAMDDINHL-UHFFFAOYSA-N |
| SMILES | COc1cc(C(N)=O)ccc1-c1cccc(C=O)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 3'-Formyl-2-methoxy-[1,1'-biphenyl]-4-carboxamide? |
| A: The English name of 3'-Formyl-2-methoxy-[1,1'-biphenyl]-4-carboxamide is 3'-Formyl-2-methoxy-[1,1'-biphenyl]-4-carboxamide. |
| Q: What is the molecular weight of 3'-Formyl-2-methoxy-[1,1'-biphenyl]-4-carboxamide? |
| A: Molecular weight of 3'-Formyl-2-methoxy-[1,1'-biphenyl]-4-carboxamide is 255.27. |
| Q: What is the molecular formula of 3'-Formyl-2-methoxy-[1,1'-biphenyl]-4-carboxamide? |
| A: Molecular formula of 3'-Formyl-2-methoxy-[1,1'-biphenyl]-4-carboxamide is C15H13NO3. |
| Q: What is the SMILES notation of 3'-Formyl-2-methoxy-[1,1'-biphenyl]-4-carboxamide? |
| A: SMILES notation of 3'-Formyl-2-methoxy-[1,1'-biphenyl]-4-carboxamide is COc1cc(C(N)=O)ccc1-c1cccc(C=O)c1. |
| Q: What is the Chinese name of 1007579-93-2? |
| A: Chinese name of 1007579-93-2 is 1007579-93-2. |
| Q: What is the InChIKey of 3'-Formyl-2-methoxy-[1,1'-biphenyl]-4-carboxamide? |
| A: InChIKey of 3'-Formyl-2-methoxy-[1,1'-biphenyl]-4-carboxamide is NWJYPHAMDDINHL-UHFFFAOYSA-N. |
| Q: What is the CAS number of 3'-Formyl-2-methoxy-[1,1'-biphenyl]-4-carboxamide? |
| A: CAS number of 3'-Formyl-2-methoxy-[1,1'-biphenyl]-4-carboxamide is 1007579-93-2. |