Ethyl 3-chloro-5-aminosulfonyl-1-methylpyrazole-4-carboxylate structure
|
Common Name | Ethyl 3-chloro-5-aminosulfonyl-1-methylpyrazole-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 100784-26-7 | Molecular Weight | 267.69000 | |
| Density | 1.66 | Boiling Point | 475.376ºC at 760 mmHg | |
| Molecular Formula | C7H10ClN3O4S | Melting Point | 121-123ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 3-chloro-1-methyl-5-sulfamoylpyrazole-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.66 |
|---|---|
| Boiling Point | 475.376ºC at 760 mmHg |
| Melting Point | 121-123ºC |
| Molecular Formula | C7H10ClN3O4S |
| Molecular Weight | 267.69000 |
| Exact Mass | 267.00800 |
| PSA | 112.66000 |
| LogP | 1.67870 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.633 |
| InChIKey | VPTSMJHJEDWLSP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(Cl)nn(C)c1S(N)(=O)=O |
| HS Code | 2935009090 |
|---|
|
~%
Ethyl 3-chloro-... CAS#:100784-26-7 |
| Literature: US4668277 A1, ; |
|
~%
Ethyl 3-chloro-... CAS#:100784-26-7 |
| Literature: Journal of Heterocyclic Chemistry, , vol. 28, # 8 p. 1849 - 1852 |
|
~%
Ethyl 3-chloro-... CAS#:100784-26-7 |
| Literature: Journal of Heterocyclic Chemistry, , vol. 28, # 8 p. 1849 - 1852 |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| 3-chloro-4-ethoxycarbonyl-1-methylpyrazole-5-sulfonamide |
| Ethyl 3-chloro-1-methyl-5-sulfamoyl-1H-pyrazole-4-carboxylate |