2-Methyl-5-nitro-1H-imidazole-1-acetonitrile structure
|
Common Name | 2-Methyl-5-nitro-1H-imidazole-1-acetonitrile | ||
|---|---|---|---|---|
| CAS Number | 1008-49-7 | Molecular Weight | 166.13700 | |
| Density | 1.41g/cm3 | Boiling Point | 416ºC at 760mmHg | |
| Molecular Formula | C6H6N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.4ºC | |
| Name | 2-(2-methyl-5-nitroimidazol-1-yl)acetonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 416ºC at 760mmHg |
| Molecular Formula | C6H6N4O2 |
| Molecular Weight | 166.13700 |
| Flash Point | 205.4ºC |
| Exact Mass | 166.04900 |
| PSA | 87.43000 |
| LogP | 1.14648 |
| Vapour Pressure | 3.94E-07mmHg at 25°C |
| Index of Refraction | 1.635 |
| InChIKey | IYTZFCYXBYJPPR-UHFFFAOYSA-N |
| SMILES | Cc1ncc([N+](=O)[O-])n1CC#N |
| HS Code | 2933290090 |
|---|
|
~64%
2-Methyl-5-nitr... CAS#:1008-49-7 |
| Literature: Danan; Charon; Kirkiacharian; Bories; Loiseau Farmaco, 1997 , vol. 52, # 4 p. 227 - 229 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (2-methyl-5-nitro-imidazol-1-yl)-acetonitrile |
| Imidazole,1-(cyanomethyl)-2-methyl-5-nitro |
| 1-(Cyanomethyl)-2-methyl-5-nitroimidazole |