Dithiophosphoric acid S-[1,2-bis[[methoxy(methyl)amino]carbonyl]ethyl]O,O-dimethyl ester structure
|
Common Name | Dithiophosphoric acid S-[1,2-bis[[methoxy(methyl)amino]carbonyl]ethyl]O,O-dimethyl ester | ||
|---|---|---|---|---|
| CAS Number | 10080-80-5 | Molecular Weight | 360.38700 | |
| Density | 1.314g/cm3 | Boiling Point | 393.3ºC at 760 mmHg | |
| Molecular Formula | C10H21N2O6PS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.6ºC | |
| Name | 2-dimethoxyphosphinothioylsulfanyl-N,N'-dimethoxy-N,N'-dimethylbutanediamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.314g/cm3 |
|---|---|
| Boiling Point | 393.3ºC at 760 mmHg |
| Molecular Formula | C10H21N2O6PS2 |
| Molecular Weight | 360.38700 |
| Flash Point | 191.6ºC |
| Exact Mass | 360.05800 |
| PSA | 144.74000 |
| LogP | 1.68580 |
| Vapour Pressure | 2.16E-06mmHg at 25°C |
| Index of Refraction | 1.531 |
| InChIKey | LNICFUYFCDFXLP-UHFFFAOYSA-N |
| SMILES | CON(C)C(=O)CC(SP(=S)(OC)OC)C(=O)N(C)OC |
| ENT 27,310 |
| s-(3,8-dimethyl-4,7-dioxo-2,9-dioxa-3,8-diazadecan-5-yl) o,o-dimethyl phosphorodithioate |
| S-(1,2-Bis((methoxymethylamino)carbonyl)ethyl) O,O-dimethyl phosphorodithioate |
| Phosphorodithioic acid,O,O-dimethyl ester,S-ester with 2-mercapto-N,N'-dimethoxy-N,N'-dimethylsuccinamide |