5-(3,4-dimethylphenyl)-1-(4-fluorobenzyl)-1,6a-dihydropyrrolo[3,4-d][1,2,3]triazole-4,6(3aH,5H)-dione structure
|
Common Name | 5-(3,4-dimethylphenyl)-1-(4-fluorobenzyl)-1,6a-dihydropyrrolo[3,4-d][1,2,3]triazole-4,6(3aH,5H)-dione | ||
|---|---|---|---|---|
| CAS Number | 1008237-85-1 | Molecular Weight | 352.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H17FN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(3,4-dimethylphenyl)-1-(4-fluorobenzyl)-1,6a-dihydropyrrolo[3,4-d][1,2,3]triazole-4,6(3aH,5H)-dione |
|---|
| Molecular Formula | C19H17FN4O2 |
|---|---|
| Molecular Weight | 352.4 |
| InChIKey | YCENAKLSGQJLSJ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N2C(=O)C3N=NN(Cc4ccc(F)cc4)C3C2=O)cc1C |
|
Name: Inhibitors of CDC25B-CDK2/CyclinA interaction
Source: Center for Chemical Genomics, University of Michigan
External Id: MScreen:TargetID_600
|