1-(2,4-DIMETHYLBENZYL)HYDRAZINE structure
|
Common Name | 1-(2,4-DIMETHYLBENZYL)HYDRAZINE | ||
|---|---|---|---|---|
| CAS Number | 100863-82-9 | Molecular Weight | 236.30700 | |
| Density | 1.005g/cm3 | Boiling Point | 359.3ºC at 760 mmHg | |
| Molecular Formula | C14H20O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.4ºC | |
| Name | 1-(2,4-Dipropoxyphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.005g/cm3 |
|---|---|
| Boiling Point | 359.3ºC at 760 mmHg |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.30700 |
| Flash Point | 162.4ºC |
| Exact Mass | 236.14100 |
| PSA | 35.53000 |
| LogP | 3.46680 |
| Vapour Pressure | 2.4E-05mmHg at 25°C |
| Index of Refraction | 1.491 |
| InChIKey | JYOSXKGJWBSXKY-UHFFFAOYSA-N |
| SMILES | CCCOc1ccc(C(C)=O)c(OCCC)c1 |
| HS Code | 2914509090 |
|---|
|
~%
1-(2,4-DIMETHYL... CAS#:100863-82-9 |
| Literature: Chabrier et al. Bulletin de la Societe Chimique de France, 1958 , p. 1488 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2,4dipropoxyacetophenone |
| 2,4-propoxyacetophenone |